Bis-PEG6-acid structure
|
Common Name | Bis-PEG6-acid | ||
|---|---|---|---|---|
| CAS Number | 119189-70-7 | Molecular Weight | 382.403 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 543.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H30O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.7±23.6 °C | |
Use of Bis-PEG6-acidBis-PEG6-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | Bis-PEG6-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG6-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.4±50.0 °C at 760 mmHg |
| Molecular Formula | C16H30O10 |
| Molecular Weight | 382.403 |
| Flash Point | 187.7±23.6 °C |
| Exact Mass | 382.183899 |
| LogP | -2.26 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | YFBGEYNLLRKUTP-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCC(=O)O |
| 4,7,10,13,16,19-Hexaoxadocosane-1,22-dioic acid |
| MFCD20926399 |