Bis-PEG7-acid
Modify Date: 2025-08-26 20:37:39
Bis-PEG7-acid structure
|
Common Name | Bis-PEG7-acid | ||
|---|---|---|---|---|
| CAS Number | 94376-75-7 | Molecular Weight | 426.45600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H34O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bis-PEG7-acidBis-PEG7-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Bis-PEG6-propionic acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 3-(2-{2-[2-(2-{2-[2-(2-Carboxyethoxy)ethoxy]ethoxy}ethoxy)ethoxy]ethoxy}-ethoxy)propionic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG7-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Bis-PEG6-propionic acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Cleavable |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C18H34O11 |
|---|---|
| Molecular Weight | 426.45600 |
| Exact Mass | 426.21000 |
| PSA | 139.21000 |
| LogP | 0.05200 |
| InChIKey | AYUREXAVZVVOJM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| Storage condition | 2-8°C |
| HOOCCH2CH2-PEG6-CH2CH2COOH |
| α,ω-Dipropionic acid hexaethylene glycol |
| Alpha,ω-dipropionic acid hexaethylene glycol |