tert-Butyl-3-aminoazepan-1-carboxylat structure
|
Common Name | tert-Butyl-3-aminoazepan-1-carboxylat | ||
|---|---|---|---|---|
| CAS Number | 625471-04-7 | Molecular Weight | 214.305 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 296.5±33.0 °C at 760 mmHg | |
| Molecular Formula | C11H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.1±25.4 °C | |
| Name | (S)-tert-Butyl 3-aminoazepane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.5±33.0 °C at 760 mmHg |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.305 |
| Flash Point | 133.1±25.4 °C |
| Exact Mass | 214.168121 |
| PSA | 55.56000 |
| LogP | 1.11 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | WXWILWLHHQGUCX-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC(N)C1 |
| HS Code | 2933990090 |
|---|
|
~54%
tert-Butyl-3-am... CAS#:625471-04-7 |
| Literature: ASTRAZENECA AB; ASTRAZENECA UK LIMITED Patent: WO2005/66163 A2, 2005 ; Location in patent: Page/Page column 55-26 ; WO 2005/066163 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (S)-3-amino-azepane-1-carboxylic acid tert-butyl ester |
| tert-Butyl-3-aminoazepan-1-carboxylat |
| (S)-3-AMINO-1-BOC-AZEPANE |
| 1H-Azepine-1-carboxylic acid, 3-aminohexahydro-, 1,1-dimethylethyl ester |
| (3S)-3-Aminoazepane-1-carboxylic Acid tert-Butyl Ester |
| 3-Amino-azepane-1-carboxylic acid tert-butyl ester |
| 2-Methyl-2-propanyl 3-amino-1-azepanecarboxylate |
| tert-Butyl (3S)-3-aminoazepane-1-carboxylate |
| 3-Amino-azepane-1-carboxylicacidtert-butylester |
| tert-butyl 3-aminoazepane-1-carboxylate |