tert-Butyl-3-(chlormethyl)pyrrolidin-1-carboxylat
Modify Date: 2025-08-22 12:11:05
tert-Butyl-3-(chlormethyl)pyrrolidin-1-carboxylat structure
|
Common Name | tert-Butyl-3-(chlormethyl)pyrrolidin-1-carboxylat | ||
|---|---|---|---|---|
| CAS Number | 876589-13-8 | Molecular Weight | 219.708 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 284.3±13.0 °C at 760 mmHg | |
| Molecular Formula | C10H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.7±19.8 °C | |
| Name | 1-Boc-3-Chloromethylpyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 284.3±13.0 °C at 760 mmHg |
| Molecular Formula | C10H18ClNO2 |
| Molecular Weight | 219.708 |
| Flash Point | 125.7±19.8 °C |
| Exact Mass | 219.102600 |
| PSA | 29.54000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | ZCOBWMKNMWVILV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCl)C1 |
| Hazard Codes | T+ |
|---|---|
| HS Code | 2933990090 |
|
~%
tert-Butyl-3-(c... CAS#:876589-13-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 20, # 7 p. 2125 - 2128 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Pyrrolidinecarboxylic acid, 3-(chloromethyl)-, 1,1-dimethylethyl ester |
| tert-Butyl-3-(chlormethyl)pyrrolidin-1-carboxylat |
| 2-Methyl-2-propanyl 3-(chloromethyl)-1-pyrrolidinecarboxylate |
| tert-butyl 3-(chloromethyl)pyrrolidine-1-carboxylate |