1-[(tert-Butoxycarbonyl)oxy]pyrrolidine-2,5-dione
Modify Date: 2025-08-27 18:51:51
![1-[(tert-Butoxycarbonyl)oxy]pyrrolidine-2,5-dione Structure](https://image.chemsrc.com/caspic/023/13139-12-3.png)
1-[(tert-Butoxycarbonyl)oxy]pyrrolidine-2,5-dione structure
|
Common Name | 1-[(tert-Butoxycarbonyl)oxy]pyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 13139-12-3 | Molecular Weight | 215.203 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 272.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C9H13NO5 | Melting Point | -95ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 118.8±22.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-Butyl N-succinimidyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.8±23.0 °C at 760 mmHg |
| Melting Point | -95ºC (dec.) |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.203 |
| Flash Point | 118.8±22.6 °C |
| Exact Mass | 215.079376 |
| PSA | 72.91000 |
| LogP | -0.13 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | VTGFSVGZCYYHLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)ON1C(=O)CCC1=O |
| Storage condition | -20℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22;R43 |
| Safety Phrases | 36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2.0 |
| HS Code | 2925190090 |
![Carbamic acid, [2-[(2-hydroxyethyl)amino]ethyl]-, 1,1-dimethylethyl ester (9CI) structure](https://image.chemsrc.com/caspic/409/208577-84-8.png)
CAS#:208577-84-8
CAS#:625471-04-7
CAS#:117499-16-8
CAS#:15761-38-3
CAS#:95034-05-2| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Stabilization of Bacillus subtilis -amylase by amino group acylation.
Biochim. Biophys. Acta 310 , 264, (1973)
|
|
|
M. Franke et al.
Tetrahedron Lett. , 4765, (1966)
|
|
|
H. Gross, L. Bilk
Justus Liebigs Ann. Chem. 725 , 212, (1969)
|
| MFCD00037903 |
| 1-[(tert-Butoxycarbonyl)oxy]pyrrolidine-2,5-dione |
| tert-Butyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| 2,5-Pyrrolidinedione, 1-(((1,1-dimethylethoxy)carbonyl)oxy)- |
| 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}oxy)-2,5-pyrrolidinedione |
| 2,5-Pyrrolidinedione, 1-[[(1,1-dimethylethoxy)carbonyl]oxy]- |
| EINECS 236-071-1 |
| N-(tert-Butoxycarbonyloxy)succinimide |