N-(2-Cyanophenyl)-2-pyridinecarboxamide structure
|
Common Name | N-(2-Cyanophenyl)-2-pyridinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 304650-02-0 | Molecular Weight | 223.230 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 335.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C13H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.7±22.3 °C | |
| Name | N-(2-cyanophenyl)pyridine-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.5±22.0 °C at 760 mmHg |
| Molecular Formula | C13H9N3O |
| Molecular Weight | 223.230 |
| Flash Point | 156.7±22.3 °C |
| Exact Mass | 223.074554 |
| PSA | 69.27000 |
| LogP | 1.32 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | CMOBXBANKIGTSJ-UHFFFAOYSA-N |
| SMILES | N#Cc1ccccc1NC(=O)c1ccccn1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~49%
N-(2-Cyanopheny... CAS#:304650-02-0 |
| Literature: Wu, Xiao-Feng; Oschatz, Stefan; Sharif, Muhammad; Beller, Matthias; Langer, Peter Tetrahedron, 2014 , vol. 70, # 1 p. 23 - 29 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(2-Cyanophenyl)-2-pyridinecarboxamide |