3-benzyl-1,4,11-triazabicyclo[11.3.0]hexadecane-2,5,12-trione structure
|
Common Name | 3-benzyl-1,4,11-triazabicyclo[11.3.0]hexadecane-2,5,12-trione | ||
|---|---|---|---|---|
| CAS Number | 97782-03-1 | Molecular Weight | 357.44700 | |
| Density | 1.842g/cm3 | Boiling Point | 638.5ºC at 760mmHg | |
| Molecular Formula | C20H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340ºC | |
| Name | 3-benzyl-1,4,11-triazabicyclo[11.3.0]hexadecane-2,5,12-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.842g/cm3 |
|---|---|
| Boiling Point | 638.5ºC at 760mmHg |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.44700 |
| Flash Point | 340ºC |
| Exact Mass | 357.20500 |
| PSA | 85.49000 |
| LogP | 1.88480 |
| Index of Refraction | 1.858 |
| InChIKey | WQBFKZKPIQCPJO-UOQNBVRUSA-N |
| SMILES | Nc1nc(N)c2n[nH]c(C3OC(CO)C(O)C3O)c2n1 |
|
~%
3-benzyl-1,4,11... CAS#:97782-03-1 |
| Literature: Secrist, John A.; Shortnacy, Anita T.; Montgomery, John A. Journal of Medicinal Chemistry, 1985 , vol. 28, # 11 p. 1740 - 1742 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 10-benzyldodecahydro-1h-pyrrolo[2,1-c][1,4,7]triazacyclotridecine-1,8,11-trione |
| Cyclo(phe-pro-aca) |
| 2-Amino-formycin A |