2-(Methylsulfonyl)-4,6-diphenylpyrimidine structure
|
Common Name | 2-(Methylsulfonyl)-4,6-diphenylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 958727-25-8 | Molecular Weight | 310.370 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 544.2±53.0 °C at 760 mmHg | |
| Molecular Formula | C17H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.9±30.9 °C | |
| Name | 2-methylsulfonyl-4,6-diphenylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 544.2±53.0 °C at 760 mmHg |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.370 |
| Flash Point | 282.9±30.9 °C |
| Exact Mass | 310.077606 |
| PSA | 68.30000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | CGPYJRURXQHQKH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(Methylsulfonyl)-4,6-diphenylpyrimidine |
| Pyrimidine, 2-(methylsulfonyl)-4,6-diphenyl- |