2-Chloro-4,6-diphenylpyrimidine structure
|
Common Name | 2-Chloro-4,6-diphenylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 2915-16-4 | Molecular Weight | 266.725 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 469.1±14.0 °C at 760 mmHg | |
| Molecular Formula | C16H11ClN2 | Melting Point | 113.0 to 117.0 °C | |
| MSDS | N/A | Flash Point | 269.8±5.7 °C | |
| Name | 2-Chloro-4,6-diphenylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.1±14.0 °C at 760 mmHg |
| Melting Point | 113.0 to 117.0 °C |
| Molecular Formula | C16H11ClN2 |
| Molecular Weight | 266.725 |
| Flash Point | 269.8±5.7 °C |
| Exact Mass | 266.061066 |
| PSA | 25.78000 |
| LogP | 4.46 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | QNGVEVOZKYHNGL-UHFFFAOYSA-N |
| SMILES | Clc1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~86%
2-Chloro-4,6-di... CAS#:2915-16-4 |
| Literature: Schomaker; Delia Journal of Organic Chemistry, 2001 , vol. 66, # 21 p. 7125 - 7128 |
|
~98%
2-Chloro-4,6-di... CAS#:2915-16-4 |
| Literature: Ciba Specialty Chemicals Corporation Patent: US6706215 B1, 2004 ; Location in patent: Page column 40-41 ; |
|
~%
2-Chloro-4,6-di... CAS#:2915-16-4 |
| Literature: Nasielski; Standaert; Nasielski-Hinkens Synthetic Communications, 1991 , vol. 21, # 7 p. 901 - 906 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Diphenyl-2-chloropyrimidin |
| 4,6-diphenyl-2-chloropyrimidine |
| Pyrimidine, 2-chloro-4,6-diphenyl- |
| 2-chloro-4,6-diphenyl-pyrimidine |
| 2-Chloro-4,6-diphenylpyrimidine |
| 2-chloro-4,6-diphenyl-1,3-pyrimidine |
| 2-Chlor-4.6-diphenyl-pyrimidin |