1-butyl-5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one structure
|
Common Name | 1-butyl-5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 93040-68-7 | Molecular Weight | 301.30400 | |
| Density | 1.255g/cm3 | Boiling Point | 396.9ºC at 760 mmHg | |
| Molecular Formula | C15H18F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8ºC | |
| Name | 1-butyl-5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 396.9ºC at 760 mmHg |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.30400 |
| Flash Point | 193.8ºC |
| Exact Mass | 301.12900 |
| PSA | 40.54000 |
| LogP | 3.21090 |
| Index of Refraction | 1.509 |
| InChIKey | BLRDASGFCGHOHT-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)CCC1(O)c1cccc(C(F)(F)F)c1 |
|
~%
1-butyl-5-hydro... CAS#:93040-68-7 |
| Literature: Houlihan, William J.; Gogerty, John H.; Ryan, Eileen A.; Schmitt, Gemma Journal of Medicinal Chemistry, 1985 , vol. 28, # 1 p. 28 - 31 |