RNF114 ligand 1 structure
|
Common Name | RNF114 ligand 1 | ||
|---|---|---|---|---|
| CAS Number | 900137-36-2 | Molecular Weight | 283.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RNF114 ligand 1RNF114 ligand 1 is a E3 Ubiquitin ligase binder[1]. |
| Name | RNF114 ligand 1 |
|---|
| Description | RNF114 ligand 1 is a E3 Ubiquitin ligase binder[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Jessica S, ta al. Covalent targeting of e3 ligases. The US, WO2020076996A1. 2019-10-09. |
| Molecular Formula | C14H18ClNO3 |
|---|---|
| Molecular Weight | 283.75 |
| InChIKey | RZXUCAQMZIQIRL-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C2CCCN2C(=O)CCl)c1 |