S-(1-acetyl-3,3-dimethyl-2-phenylaziridin-2-yl) ethanethioate structure
|
Common Name | S-(1-acetyl-3,3-dimethyl-2-phenylaziridin-2-yl) ethanethioate | ||
|---|---|---|---|---|
| CAS Number | 89874-00-0 | Molecular Weight | 263.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(1-acetyl-3,3-dimethyl-2-phenylaziridin-2-yl) ethanethioate |
|---|
| Molecular Formula | C14H17NO2S |
|---|---|
| Molecular Weight | 263.35500 |
| Exact Mass | 263.09800 |
| PSA | 62.45000 |
| LogP | 2.69770 |
| InChIKey | RVDWJLHJMMWJLR-UHFFFAOYSA-N |
| SMILES | CC(=O)SC1(c2ccccc2)N(C(C)=O)C1(C)C |
|
~%
S-(1-acetyl-3,3... CAS#:89874-00-0 |
| Literature: Sakamoto, Masami; Aoyama, Hiromu; Omote, Yoshimori Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1837 - 1838 |
|
~%
S-(1-acetyl-3,3... CAS#:89874-00-0 |
| Literature: Sakamoto, Masami; Aoyama, Hiromu; Omote, Yoshimori Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1837 - 1838 |