ethyl 3-(4-bromo-2-methoxyphenyl)iminobutanoate structure
|
Common Name | ethyl 3-(4-bromo-2-methoxyphenyl)iminobutanoate | ||
|---|---|---|---|---|
| CAS Number | 89446-10-6 | Molecular Weight | 314.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-(4-bromo-2-methoxyphenyl)iminobutanoate |
|---|
| Molecular Formula | C13H16BrNO3 |
|---|---|
| Molecular Weight | 314.17500 |
| Exact Mass | 313.03100 |
| PSA | 47.89000 |
| LogP | 3.50330 |
| InChIKey | LNFBZADASGYZCO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)=Nc1ccc(Br)cc1OC |
|
~79%
ethyl 3-(4-brom... CAS#:89446-10-6 |
| Literature: Davis, Steven E.; Rauckman, Barbara S.; Chan, Joseph H.; Roth, Barbara Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1936 - 1942 |
|
~%
ethyl 3-(4-brom... CAS#:89446-10-6 |
| Literature: Davis, Steven E.; Rauckman, Barbara S.; Chan, Joseph H.; Roth, Barbara Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1936 - 1942 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |