2-[(6-amino-2-methylsulfanylpyrimidin-4-yl)amino]-6-methylpyridine-3-thiol structure
|
Common Name | 2-[(6-amino-2-methylsulfanylpyrimidin-4-yl)amino]-6-methylpyridine-3-thiol | ||
|---|---|---|---|---|
| CAS Number | 81587-39-5 | Molecular Weight | 279.38400 | |
| Density | 1.39g/cm3 | Boiling Point | 480.2ºC at 760 mmHg | |
| Molecular Formula | C11H13N5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.2ºC | |
| Name | 2-[(6-amino-2-methylsulfanylpyrimidin-4-yl)amino]-6-methylpyridine-3-thiol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 480.2ºC at 760 mmHg |
| Molecular Formula | C11H13N5S2 |
| Molecular Weight | 279.38400 |
| Flash Point | 244.2ºC |
| Exact Mass | 279.06100 |
| PSA | 144.05000 |
| LogP | 2.51950 |
| Index of Refraction | 1.7 |
| InChIKey | VFDXJOUOYOTEFU-UHFFFAOYSA-N |
| SMILES | CSc1nc(N)cc(Nc2nc(C)ccc2S)n1 |
|
~%
2-[(6-amino-2-m... CAS#:81587-39-5 |
| Literature: Okafor; Steenberg; Buckley Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 1 p. 302 - 318 |
|
~%
2-[(6-amino-2-m... CAS#:81587-39-5 |
| Literature: Okafor; Steenberg; Buckley Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 1 p. 302 - 318 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Pyridinethiol,2-((4-amino-2-(methylthio)-6-pyrimidinyl)amino)-6-methyl |
| 2-((4-AMINO-2-(METHYLTHIO)-PYRIMIDIN-6-YL)AMINO)-6-METHYL-PYRIDINE-3-THIOL |
| 2-(4-Amino-2-methylthiopyrimidin-6-ylamino)-6-methyl-1H-pyridinium-3-thiolate |