1,1,2,2,3,3-hexakis(2,6-dimethylphenyl)trisilirane
Modify Date: 2025-09-27 13:30:00
1,1,2,2,3,3-hexakis(2,6-dimethylphenyl)trisilirane structure
|
Common Name | 1,1,2,2,3,3-hexakis(2,6-dimethylphenyl)trisilirane | ||
|---|---|---|---|---|
| CAS Number | 80584-59-4 | Molecular Weight | 715.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C48H54Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2,3,3-hexakis(2,6-dimethylphenyl)trisilirane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C48H54Si3 |
|---|---|
| Molecular Weight | 715.19900 |
| Exact Mass | 714.35300 |
| LogP | 7.72560 |
| InChIKey | WHKHATOPODMLLF-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1[Si]1(c2c(C)cccc2C)[Si](c2c(C)cccc2C)(c2c(C)cccc2C)[Si]1(c1c(C)cccc1C)c1c(C)cccc1C |
|
~9%
1,1,2,2,3,3-hex... CAS#:80584-59-4 |
| Literature: Masamune,S.; Hanzawa,Y.; Murakami,S. Journal of the American Chemical Society, 1982 , vol. 104, p. 1150 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Cyclotrisilane,hexakis(2,6-dimethylphenyl) |