2-methyl-2-(4-methylphenoxy)propanamide structure
|
Common Name | 2-methyl-2-(4-methylphenoxy)propanamide | ||
|---|---|---|---|---|
| CAS Number | 76423-62-6 | Molecular Weight | 193.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-2-(4-methylphenoxy)propanamide |
|---|
| Molecular Formula | C11H15NO2 |
|---|---|
| Molecular Weight | 193.24200 |
| Exact Mass | 193.11000 |
| PSA | 53.31000 |
| LogP | 2.78740 |
| InChIKey | HKMQXKKRSRYBDV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(C)(C)C(N)=O)cc1 |
|
~%
2-methyl-2-(4-m... CAS#:76423-62-6 |
| Literature: Coutts, Ian G. C.; Southcott, Mark R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , p. 767 - 771 |