2-Methyl-2-(4-methylphenoxy)propanoyl chloride structure
|
Common Name | 2-Methyl-2-(4-methylphenoxy)propanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 116762-24-4 | Molecular Weight | 212.67300 | |
| Density | N/A | Boiling Point | 272.3ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.5ºC | |
| Name | 2-Methyl-2-(4-methylphenoxy)propanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 272.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.67300 |
| Flash Point | 101.5ºC |
| Exact Mass | 212.06000 |
| PSA | 26.30000 |
| LogP | 2.91780 |
| Vapour Pressure | 0.00612mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | NNHUHOBNVSNTGT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(C)(C)C(=O)Cl)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
2-Methyl-2-(4-m... CAS#:116762-24-4 |
| Literature: Tetrahedron, , vol. 43, # 22 p. 5335 - 5340 |
|
~%
2-Methyl-2-(4-m... CAS#:116762-24-4 |
| Literature: Journal of the American Chemical Society, , vol. 135, # 20 p. 7567 - 7571 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-(p-tolyloxy)propanoyl chloride |