(4-acetyl-2-acetyloxyphenyl) acetate structure
|
Common Name | (4-acetyl-2-acetyloxyphenyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 72712-21-1 | Molecular Weight | 236.22100 | |
| Density | 1.203g/cm3 | Boiling Point | 379.2ºC at 760 mmHg | |
| Molecular Formula | C12H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5ºC | |
| Name | (4-acetyl-2-acetyloxyphenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 379.2ºC at 760 mmHg |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22100 |
| Flash Point | 169.5ºC |
| Exact Mass | 236.06800 |
| PSA | 69.67000 |
| LogP | 1.73980 |
| Index of Refraction | 1.512 |
| InChIKey | DBRDKWNUFUAJKH-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(C(C)=O)cc1OC(C)=O |
| HS Code | 2918300090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Acetic acid 2-acetoxy-5-acetyl-phenyl ester |
| 1-(3,4-diacetoxy-phenyl)-ethanone |
| 3,4-diacetoxyacetophenone |
| 3,4-Diacetoxy-acetophenon |
| 1-(3,4-Diacetoxy-phenyl)-aethanon |