3,4-dihydroxy-4-[(3E,6E)-tetradeca-3,6-dienoyl]oxybutanoic acid structure
|
Common Name | 3,4-dihydroxy-4-[(3E,6E)-tetradeca-3,6-dienoyl]oxybutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 67701-29-5 | Molecular Weight | 342.42700 | |
| Density | 1.116g/cm3 | Boiling Point | 528.8ºC at 760 mmHg | |
| Molecular Formula | C18H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175ºC | |
| Name | 3,4-dihydroxy-4-[(3E,6E)-tetradeca-3,6-dienoyl]oxybutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 528.8ºC at 760 mmHg |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.42700 |
| Flash Point | 175ºC |
| Exact Mass | 342.20400 |
| PSA | 104.06000 |
| LogP | 2.93670 |
| Index of Refraction | 1.51 |
| InChIKey | HRNGDAQBEIFYGL-MVKOLZDDSA-N |
| SMILES | CCCCCCCC=CCC=CCC(=O)OC(O)C(O)CC(=O)O |
| Safety Phrases | 23-24/25 |
|---|
| EINECS 266-947-9 |
| SDA 04-001-00 |
| Glycerides,C14-18 and C16-18-unsatd. |
| SDA 04-004-00 |