2,5,7-trimethyl-1H-quinolin-4-one structure
|
Common Name | 2,5,7-trimethyl-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 65674-07-9 | Molecular Weight | 187.23800 | |
| Density | 1.084g/cm3 | Boiling Point | 317.2ºC at 760 mmHg | |
| Molecular Formula | C12H13NO | Melting Point | N/A | |
| MSDS | USA | Flash Point | 131.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5,7-trimethyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 317.2ºC at 760 mmHg |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.23800 |
| Flash Point | 131.2ºC |
| Exact Mass | 187.10000 |
| PSA | 33.12000 |
| LogP | 2.86560 |
| Index of Refraction | 1.56 |
| InChIKey | RLAFUJHEIQCSIU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(=O)cc(C)[nH]c2c1 |
|
~%
2,5,7-trimethyl... CAS#:65674-07-9 |
| Literature: Backeberg; Friedmann Journal of the Chemical Society, 1938 , p. 972,976 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5,7-Trimethyl-chinolin-4-ol |
| 2,5,7-trimethylquinolin-4-ol |
| F0914-2370 |
| 2,5,7-Trimethyl-4-quinolinol |
| 4-Hydroxy-2,5,7-trimethylquinoline |