2-(nitromethyl)isoindole-1,3-dione
Modify Date: 2025-09-22 17:33:32
2-(nitromethyl)isoindole-1,3-dione structure
|
Common Name | 2-(nitromethyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 65004-95-7 | Molecular Weight | 206.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(nitromethyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6N2O4 |
|---|---|
| Molecular Weight | 206.15500 |
| Exact Mass | 206.03300 |
| PSA | 83.20000 |
| LogP | 0.97790 |
| InChIKey | YDDMBNGWLKLHOJ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1C[N+](=O)[O-] |
|
~%
2-(nitromethyl)... CAS#:65004-95-7 |
| Literature: Kissinger; Ungnade Journal of Organic Chemistry, 1958 , vol. 23, p. 815,818 |
|
~%
2-(nitromethyl)... CAS#:65004-95-7 |
| Literature: Kissinger; Ungnade Journal of Organic Chemistry, 1958 , vol. 23, p. 815,818 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-nitromethylphtalimide |
| N-Nitromethylphthalimid |
| 1H-Isoindole-1,3(2H)-dione,2-(nitromethyl) |
| 2-Nitromethyl-isoindole-1,3-dione |
| N-nitromethyl-phthalimide |