1,3-diazido-2-methylbenzene
Modify Date: 2025-09-09 19:25:32
1,3-diazido-2-methylbenzene structure
|
Common Name | 1,3-diazido-2-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 646054-87-7 | Molecular Weight | 174.16300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-diazido-2-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6N6 |
|---|---|
| Molecular Weight | 174.16300 |
| Exact Mass | 174.06500 |
| PSA | 99.50000 |
| LogP | 2.78412 |
| InChIKey | QKXIYRJSJBECNX-UHFFFAOYSA-N |
| SMILES | Cc1c(N=[N+]=[N-])cccc1N=[N+]=[N-] |
|
~33%
1,3-diazido-2-m... CAS#:646054-87-7 |
| Literature: Chapyshev, Sergei Viktorovich; Tomioko, Hideo Bulletin of the Chemical Society of Japan, 2003 , vol. 76, # 11 p. 2075 - 2090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzene,1,3-diazido-2-methyl |
| 2,6-diazidotoluene |