Methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate structure
|
Common Name | Methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate | ||
|---|---|---|---|---|
| CAS Number | 6386-39-6 | Molecular Weight | 250.33300 | |
| Density | 1.042g/cm3 | Boiling Point | 330ºC at 760 mmHg | |
| Molecular Formula | C15H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.9ºC | |
| Name | methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 330ºC at 760 mmHg |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33300 |
| Flash Point | 126.9ºC |
| Exact Mass | 250.15700 |
| PSA | 46.53000 |
| LogP | 3.10370 |
| Index of Refraction | 1.51 |
| InChIKey | FQCQJBVYSORVEW-UHFFFAOYSA-N |
| SMILES | COC(=O)CCc1cc(C)c(O)c(C(C)(C)C)c1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| AC-5022 |
| Methyl-3-(3-tert.-butyl-4-hydroxy-5-methylphenyl)propionat |
| Methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate |