1-chloro-3-methylsulfonyl-5-nitrobenzene structure
|
Common Name | 1-chloro-3-methylsulfonyl-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 62606-14-8 | Molecular Weight | 235.64500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-3-methylsulfonyl-5-nitrobenzene |
|---|
| Molecular Formula | C7H6ClNO4S |
|---|---|
| Molecular Weight | 235.64500 |
| Exact Mass | 234.97100 |
| PSA | 88.34000 |
| LogP | 3.25570 |
| InChIKey | JODICKQEXNVUDV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(Cl)cc([N+](=O)[O-])c1 |
|
~%
1-chloro-3-meth... CAS#:62606-14-8 |
| Literature: Emokpae,T.A.; Dosunma,I.M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 14 - 17 |
|
~%
1-chloro-3-meth... CAS#:62606-14-8 |
| Literature: Emokpae,T.A.; Dosunma,I.M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 14 - 17 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |