1-[chloro-(3,5-dimethylphenoxy)phosphoryl]oxy-3,5-dimethyl-benzene structure
|
Common Name | 1-[chloro-(3,5-dimethylphenoxy)phosphoryl]oxy-3,5-dimethyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 58377-73-4 | Molecular Weight | 324.73900 | |
| Density | 1.221g/cm3 | Boiling Point | 436.3ºC at 760 mmHg | |
| Molecular Formula | C16H18ClO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.3ºC | |
| Name | 1-[chloro-(3,5-dimethylphenoxy)phosphoryl]oxy-3,5-dimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760 mmHg |
| Molecular Formula | C16H18ClO3P |
| Molecular Weight | 324.73900 |
| Flash Point | 350.3ºC |
| Exact Mass | 324.06800 |
| PSA | 45.34000 |
| LogP | 5.72490 |
| Index of Refraction | 1.556 |
| InChIKey | VYHGCXOQLBEEJN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(OP(=O)(Cl)Oc2cc(C)cc(C)c2)c1 |
|
~%
1-[chloro-(3,5-... CAS#:58377-73-4 |
| Literature: Orloff et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 727,729 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| chlorophosphoric acid bis-(3,5-dimethyl-phenyl ester) |
| bis(3,5-dimethylphenyl) chlorophosphate |
| Chlorophosphorsaeure-bis-(3,5-dimethyl-phenylester) |
| bis(3,5-dimethylphenyl) phosphorochloridate |