4-(4-chloro-3-phenylpyrazol-1-yl)morpholine structure
|
Common Name | 4-(4-chloro-3-phenylpyrazol-1-yl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 62565-38-2 | Molecular Weight | 263.72300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-chloro-3-phenylpyrazol-1-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14ClN3O |
|---|---|
| Molecular Weight | 263.72300 |
| Exact Mass | 263.08300 |
| PSA | 30.29000 |
| LogP | 2.23670 |
| InChIKey | HQGKOFZVZZGQGM-UHFFFAOYSA-N |
| SMILES | Clc1cn(N2CCOCC2)nc1-c1ccccc1 |
|
~%
4-(4-chloro-3-p... CAS#:62565-38-2 |
| Literature: Kishimoto; Noguchi; Masuda Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 12 p. 3001 - 3010 |
|
~%
4-(4-chloro-3-p... CAS#:62565-38-2 |
| Literature: Kishimoto; Noguchi; Masuda Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 12 p. 3001 - 3010 |
|
~%
4-(4-chloro-3-p... CAS#:62565-38-2 |
| Literature: Kishimoto; Noguchi; Masuda Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 12 p. 3001 - 3010 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-1-morpholino-3-phenylpyrazol |