4-(4,5-dichloro-3-phenylpyrazol-1-yl)morpholine structure
|
Common Name | 4-(4,5-dichloro-3-phenylpyrazol-1-yl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 62565-39-3 | Molecular Weight | 298.16800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4,5-dichloro-3-phenylpyrazol-1-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13Cl2N3O |
|---|---|
| Molecular Weight | 298.16800 |
| Exact Mass | 297.04400 |
| PSA | 30.29000 |
| LogP | 2.89010 |
| InChIKey | WSKXYUOCGGFGFF-UHFFFAOYSA-N |
| SMILES | Clc1c(-c2ccccc2)nn(N2CCOCC2)c1Cl |
|
~%
4-(4,5-dichloro... CAS#:62565-39-3 |
| Literature: Kishimoto; Noguchi; Masuda Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 12 p. 3001 - 3010 |
|
~%
4-(4,5-dichloro... CAS#:62565-39-3 |
| Literature: Kishimoto; Noguchi; Masuda Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 12 p. 3001 - 3010 |
|
~%
4-(4,5-dichloro... CAS#:62565-39-3 |
| Literature: Kishimoto; Noguchi; Masuda Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 12 p. 3001 - 3010 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,5-Dichlor-1-morpholino-3-phenylpyrazol |