N-acetyl-N-[4-[[4-(diacetylamino)phenyl]methyl]phenyl]acetamide structure
|
Common Name | N-acetyl-N-[4-[[4-(diacetylamino)phenyl]methyl]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 62477-14-9 | Molecular Weight | 366.41000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-acetyl-N-[4-[[4-(diacetylamino)phenyl]methyl]phenyl]acetamide |
|---|
| Molecular Formula | C21H22N2O4 |
|---|---|
| Molecular Weight | 366.41000 |
| Exact Mass | 366.15800 |
| PSA | 74.76000 |
| LogP | 3.07620 |
| InChIKey | BWSIFLVAKJEREI-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C(C)=O)c1ccc(Cc2ccc(N(C(C)=O)C(C)=O)cc2)cc1 |
|
~%
N-acetyl-N-[4-[... CAS#:62477-14-9 |
| Literature: Wagner Journal of the American Chemical Society, 1934 , vol. 56, p. 1944 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |