1-(3,4-dihydroxynaphthalen-2-yl)pentan-1-one structure
|
Common Name | 1-(3,4-dihydroxynaphthalen-2-yl)pentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61983-13-9 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,4-dihydroxynaphthalen-2-yl)pentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 57.53000 |
| LogP | 3.62390 |
| InChIKey | JGTNYZOGDRPDPR-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)c1cc2ccccc2c(O)c1O |
|
~25%
1-(3,4-dihydrox... CAS#:61983-13-9 |
| Literature: Takuwa; Kai Bulletin of the Chemical Society of Japan, 1990 , vol. 63, # 2 p. 623 - 625 |
| 3-Valeryl-naphthalindiol-(1,2) |
| 1-Pentanone,1-(3,4-dihydroxy-2-naphthalenyl) |