2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile structure
|
Common Name | 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 61875-40-9 | Molecular Weight | 185.13900 | |
| Density | 1.51g/cm3 | Boiling Point | 562.3ºC at 760 mmHg | |
| Molecular Formula | C9H3N3O2 | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | 293.8ºC | |
| Name | 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 562.3ºC at 760 mmHg |
| Melting Point | >300ºC |
| Molecular Formula | C9H3N3O2 |
| Molecular Weight | 185.13900 |
| Flash Point | 293.8ºC |
| Exact Mass | 185.02300 |
| PSA | 82.65000 |
| Index of Refraction | 1.669 |
| InChIKey | NBOKWKXETLTPQV-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
|
~%
2,3-dioxo-1,4-d... CAS#:61875-40-9 |
| Literature: US5514680 A1, ; US 5514680 A |
|
~%
2,3-dioxo-1,4-d... CAS#:61875-40-9 |
| Literature: Journal of the Chemical Society, , p. 2816,2819 |
|
~%
2,3-dioxo-1,4-d... CAS#:61875-40-9 |
| Literature: Journal of the Chemical Society, , p. 2816,2819 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,3-DIOXO-1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBONITRILE |
| 6-Cyano-2,3-dihydroxyquinoxaline |
| 2,3-Dioxo-1,2,3,4-tetrahydro-chinoxalin-6-carbonitril |
| 6-cyano-1,4-dihydro-quinoxaline-2,3-dione |