Methyl 2,3-dihydroxy-6-quinoxalinecarboxylate structure
|
Common Name | Methyl 2,3-dihydroxy-6-quinoxalinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 354793-04-7 | Molecular Weight | 220.182 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 511.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.0±28.7 °C | |
| Name | methyl 2,3-dioxo-1,4-dihydroquinoxaline-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.2±45.0 °C at 760 mmHg |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.182 |
| Flash Point | 263.0±28.7 °C |
| Exact Mass | 220.048401 |
| PSA | 92.02000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | NWNGKOXONKYINR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
Methyl 2,3-dihy... CAS#:354793-04-7 |
| Literature: Pfizer Inc. Patent: US2004/192698 A1, 2004 ; Location in patent: Page/Page column 18 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2,3-dioxo-1,2,3,4-tetrahydro-6-quinoxalinecarboxylate |
| 6-Quinoxalinecarboxylic acid, 2,3-dihydroxy-, methyl ester |
| methyl 2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylate |
| Methyl 2,3-dihydroxy-6-quinoxalinecarboxylate |
| 2,3-dioxo-1,2,3,4-tetrahydro-quinoxaline-6-carboxylic acid methyl ester |