N-(2-acetylphenyl)-2,2-dichloroacetamide structure
|
Common Name | N-(2-acetylphenyl)-2,2-dichloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 6140-12-1 | Molecular Weight | 246.09000 | |
| Density | 1.388g/cm3 | Boiling Point | 402ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9ºC | |
| Name | N-(2-acetylphenyl)-2,2-dichloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 402ºC at 760 mmHg |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09000 |
| Flash Point | 196.9ºC |
| Exact Mass | 245.00100 |
| PSA | 49.66000 |
| LogP | 3.28090 |
| Index of Refraction | 1.595 |
| InChIKey | RXPVDFOFHSWFKA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccccc1NC(=O)C(Cl)Cl |
|
~55%
N-(2-acetylphen... CAS#:6140-12-1 |
| Literature: Giuliani; Lembo; Sasso; Sorrentino; Silipo; Vittoria Farmaco, Edizione Scientifica, 1983 , vol. 38, # 11 p. 847 - 864 |
|
~%
N-(2-acetylphen... CAS#:6140-12-1 |
| Literature: Batanero, Belen; Barba, Fructuoso Journal of Organic Chemistry, 2003 , vol. 68, # 9 p. 3706 - 3709 |
| o-Dichloroacetamidoacetophenon |
| 2-Dichloracetamino-acetophenon |