5-(2-methylphenyl)-3-phenyl-1H-pyrazole
Modify Date: 2025-09-29 18:51:17
5-(2-methylphenyl)-3-phenyl-1H-pyrazole structure
|
Common Name | 5-(2-methylphenyl)-3-phenyl-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 61001-55-6 | Molecular Weight | 234.29600 | |
| Density | 1.127g/cm3 | Boiling Point | 431.9ºC at 760 mmHg | |
| Molecular Formula | C16H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | 5-(2-methylphenyl)-3-phenyl-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 431.9ºC at 760 mmHg |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.29600 |
| Flash Point | 197.4ºC |
| Exact Mass | 234.11600 |
| PSA | 28.68000 |
| LogP | 4.05210 |
| Index of Refraction | 1.617 |
| InChIKey | MBKXKNYVDJIIGU-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1cc(-c2ccccc2)n[nH]1 |
|
~89%
5-(2-methylphen... CAS#:61001-55-6 |
| Literature: Toja; Omodei-Sale; Cattaneo; Galliani European Journal of Medicinal Chemistry, 1982 , vol. 17, # 3 p. 223 - 227 |
| Pyrazole,3-phenyl-5-(o-tolyl) |
| 3-Phenyl-5-(o-tolyl)-pyrazole |