5-Phenyl-3-(o-tolyl)-1H-1,2,4-triazole structure
|
Common Name | 5-Phenyl-3-(o-tolyl)-1H-1,2,4-triazole | ||
|---|---|---|---|---|
| CAS Number | 60510-57-8 | Molecular Weight | 235.28400 | |
| Density | 1.17g/cm3 | Boiling Point | 452.6ºC at 760 mmHg | |
| Molecular Formula | C15H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2ºC | |
| Name | 5-(2-methylphenyl)-3-phenyl-1H-1,2,4-triazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 452.6ºC at 760 mmHg |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.28400 |
| Flash Point | 210.2ºC |
| Exact Mass | 235.11100 |
| PSA | 41.57000 |
| LogP | 3.44710 |
| Index of Refraction | 1.622 |
| InChIKey | LUPHUKWXQVNVCX-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1nc(-c2ccccc2)n[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Phenyl-3-(o-tolyl)-s-triazole |
| 1H-1,2,4-Triazole,3-(2-methylphenyl)-5-phenyl |
| 3-Phenyl-5-(2-tolyl)-1,2,4-triazol |
| 3-phenyl-5-o-tolyl-1H-[1,2,4]triazole |
| s-Triazole,5-phenyl-3-(o-tolyl) |
| 3-(2-Methylphenyl)-5-phenyl-1H-1,2,4-triazole |