2-hydroxybenzoic acid,1,3,7-trimethylpurine-2,6-dione
Modify Date: 2025-08-24 20:21:40
2-hydroxybenzoic acid,1,3,7-trimethylpurine-2,6-dione structure
|
Common Name | 2-hydroxybenzoic acid,1,3,7-trimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 5743-22-6 | Molecular Weight | 332.31100 | |
| Density | N/A | Boiling Point | 416.8ºC at 760mmHg | |
| Molecular Formula | C15H16N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | 2-hydroxybenzoic acid,1,3,7-trimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 416.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.31100 |
| Flash Point | 205.9ºC |
| Exact Mass | 332.11200 |
| PSA | 119.35000 |
| LogP | 0.06110 |
| InChIKey | SVXXBCDDJXZXOZ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.O=C(O)c1ccccc1O |
|
~%
2-hydroxybenzoi... CAS#:5743-22-6 |
| Literature: Goyal, Sachit; Thorson, Michael R.; Zhang, Geoff G. Z.; Gong, Yuchuan; Kenis, Paul J. A. Crystal Growth and Design, 2012 , vol. 12, # 12 p. 6023 - 6034 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3,7-Trimethyl-3,7-dihydro-purin-2,6-dion |
| Caffeine salicylate |
| EINECS 227-259-4 |
| Kaffein,Salicylat |
| 1,3,7-trimethyl-3,7-dihydro-purine-2,6-dione,caffeine,salicylate |
| Salicylic acid,compd. with caffeine (1:1) |