5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one
Modify Date: 2025-08-25 23:25:00
![5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one Structure](https://image.chemsrc.com/caspic/363/56948-75-5.png)
5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one structure
|
Common Name | 5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 56948-75-5 | Molecular Weight | 245.19800 | |
| Density | 1.406g/cm3 | Boiling Point | 388.6ºC at 760 mmHg | |
| Molecular Formula | C11H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.8ºC | |
| Name | 5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 388.6ºC at 760 mmHg |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.19800 |
| Flash Point | 188.8ºC |
| Exact Mass | 245.06600 |
| PSA | 52.82000 |
| LogP | 2.03640 |
| Index of Refraction | 1.518 |
| InChIKey | AVRJMHGSIAZZQT-UHFFFAOYSA-N |
| SMILES | O=C1CCC(O)(c2cccc(C(F)(F)F)c2)N1 |
| HS Code | 2933790090 |
|---|
|
~%
5-hydroxy-5-[3-... CAS#:56948-75-5 |
| Literature: Houlihan, William J.; Gogerty, John H.; Ryan, Eileen A.; Schmitt, Gemma Journal of Medicinal Chemistry, 1985 , vol. 28, # 1 p. 28 - 31 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |