2-[(4-ethoxyphenyl)amino]pyridine-3-carboxylic acid
Modify Date: 2025-11-26 11:59:54
![2-[(4-ethoxyphenyl)amino]pyridine-3-carboxylic acid Structure](https://image.chemsrc.com/caspic/206/4394-10-9.png)
2-[(4-ethoxyphenyl)amino]pyridine-3-carboxylic acid structure
|
Common Name | 2-[(4-ethoxyphenyl)amino]pyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4394-10-9 | Molecular Weight | 258.27300 | |
| Density | 1.28g/cm3 | Boiling Point | 432.5ºC at 760mmHg | |
| Molecular Formula | C14H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | 2-(4-ethoxyanilino)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 432.5ºC at 760mmHg |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.27300 |
| Flash Point | 215.4ºC |
| Exact Mass | 258.10000 |
| PSA | 71.45000 |
| LogP | 2.99510 |
| Index of Refraction | 1.632 |
| InChIKey | XDQXIFDNJLJUPZ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(Nc2ncccc2C(=O)O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~98%
2-[(4-ethoxyphe... CAS#:4394-10-9 |
| Literature: Li, Zhenghua; Xiao, Shangyou; Liang, Ronghui; Xia, Zhining Research on Chemical Intermediates, 2012 , vol. 38, # 7 p. 1691 - 1697 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD03119353 |