Methyl 4,5,6-trimethoxy-2-naphthoate structure
|
Common Name | Methyl 4,5,6-trimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 4147-34-6 | Molecular Weight | 276.28500 | |
| Density | 1.183g/cm3 | Boiling Point | 408.7ºC at 760 mmHg | |
| Molecular Formula | C15H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | Methyl 4,5,6-trimethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 408.7ºC at 760 mmHg |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.28500 |
| Flash Point | 181.3ºC |
| Exact Mass | 276.10000 |
| PSA | 53.99000 |
| LogP | 2.65220 |
| Index of Refraction | 1.563 |
| InChIKey | XUVRNWHBEHUNAU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(OC)c(OC)ccc2c1 |
|
~%
Methyl 4,5,6-tr... CAS#:4147-34-6 |
| Literature: Brown,A.G.; Thomson,R.H. Journal of the Chemical Society, 1965 , p. 4292 - 4295 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Indene-1-carboxylic acid,2,3-dihydro-4,5,6-trimethoxy |
| 4,5,6-TRIMETHOXYINDAN-1-CARBOXYLIC ACID |