4-(4-aminophenyl)-2-methoxyaniline
Modify Date: 2024-01-09 20:08:27
4-(4-aminophenyl)-2-methoxyaniline structure
|
Common Name | 4-(4-aminophenyl)-2-methoxyaniline | ||
|---|---|---|---|---|
| CAS Number | 3365-87-5 | Molecular Weight | 214.26300 | |
| Density | 1.169g/cm3 | Boiling Point | 374.5ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.2ºC | |
| Name | 4-(4-aminophenyl)-2-methoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 374.5ºC at 760 mmHg |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26300 |
| Flash Point | 196.2ºC |
| Exact Mass | 214.11100 |
| PSA | 61.27000 |
| LogP | 3.68900 |
| Index of Refraction | 1.639 |
| InChIKey | ZDFDINMHFLFYGQ-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2ccc(N)cc2)ccc1N |
| HS Code | 2922299090 |
|---|
|
~%
4-(4-aminopheny... CAS#:3365-87-5 |
| Literature: Sciarini Archives of Biochemistry, 1957 , vol. 71, p. 437,439 |
|
~%
4-(4-aminopheny... CAS#:3365-87-5 |
| Literature: Sciarini Archives of Biochemistry, 1957 , vol. 71, p. 437,439 |
|
~%
4-(4-aminopheny... CAS#:3365-87-5 |
| Literature: Croce; Gettler Journal of the American Chemical Society, 1953 , vol. 75, p. 874,875 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-diamino-3-methoxybiphenyl |
| 3-Methoxy-benzidin |
| 3-Methoxybenzidine |