1,2,3,4,5-pentafluoro-6-prop-2-enoxybenzene structure
|
Common Name | 1,2,3,4,5-pentafluoro-6-prop-2-enoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 33104-02-8 | Molecular Weight | 224.12700 | |
| Density | 1.378g/cm3 | Boiling Point | 59ºC/12mm | |
| Molecular Formula | C9H5F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 75.6ºC | |
| Name | 1,2,3,4,5-pentafluoro-6-prop-2-enoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 59ºC/12mm |
| Molecular Formula | C9H5F5O |
| Molecular Weight | 224.12700 |
| Flash Point | 75.6ºC |
| Exact Mass | 224.02600 |
| PSA | 9.23000 |
| LogP | 2.94690 |
| Index of Refraction | 1.428 |
| InChIKey | MYRHORGTVILPRU-UHFFFAOYSA-N |
| SMILES | C=CCOc1c(F)c(F)c(F)c(F)c1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2909309090 |
|
~60%
1,2,3,4,5-penta... CAS#:33104-02-8 |
| Literature: Boutevin, B.; Youssef, B.; Boileau, S.; Garnault, A. M. Journal of Fluorine Chemistry, 1987 , vol. 35, p. 399 - 410 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Pentafluorphenyl-prop-2-enylether |
| Pentafluorphenyl-allyl-ether |
| Allyl pentafluorophenyl ether |
| pentafluorophenyl-prop-2-enyl ether |