N-(1-adamantyl)-2,2,3,3,3-pentafluoropropan-1-imine
Modify Date: 2025-08-25 18:21:37
N-(1-adamantyl)-2,2,3,3,3-pentafluoropropan-1-imine structure
|
Common Name | N-(1-adamantyl)-2,2,3,3,3-pentafluoropropan-1-imine | ||
|---|---|---|---|---|
| CAS Number | 31224-44-9 | Molecular Weight | 281.26500 | |
| Density | 1.46g/cm3 | Boiling Point | 250.3ºC at 760 mmHg | |
| Molecular Formula | C13H16F5N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.2ºC | |
| Name | N-(1-adamantyl)-2,2,3,3,3-pentafluoropropan-1-imine |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 250.3ºC at 760 mmHg |
| Molecular Formula | C13H16F5N |
| Molecular Weight | 281.26500 |
| Flash Point | 105.2ºC |
| Exact Mass | 281.12000 |
| PSA | 12.36000 |
| LogP | 4.22360 |
| Index of Refraction | 1.525 |
| InChIKey | RYDMYGVDLQMMCE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C=NC12CC3CC(CC(C3)C1)C2 |
| HS Code | 2921300090 |
|---|
|
~%
N-(1-adamantyl)... CAS#:31224-44-9 |
| Literature: Crank; Harding; Szinai Journal of medicinal chemistry, 1970 , vol. 13, # 6 p. 1212 - 1215 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |