1,1,3,5,6-Pentachlorononafluorohexane structure
|
Common Name | 1,1,3,5,6-Pentachlorononafluorohexane | ||
|---|---|---|---|---|
| CAS Number | 307-26-6 | Molecular Weight | 420.31500 | |
| Density | 1.797g/cm3 | Boiling Point | 270.5ºC at 760mmHg | |
| Molecular Formula | C6Cl5F9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.1ºC | |
| Name | 1,1,3,5,6-Pentachlorononafluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.797g/cm3 |
|---|---|
| Boiling Point | 270.5ºC at 760mmHg |
| Molecular Formula | C6Cl5F9 |
| Molecular Weight | 420.31500 |
| Flash Point | 142.1ºC |
| Exact Mass | 417.83000 |
| LogP | 5.99870 |
| Index of Refraction | 1.394 |
| InChIKey | DVAVTWDOWVBESE-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2903799090 |
|
~%
1,1,3,5,6-Penta... CAS#:307-26-6
Detail
|
| Literature: Journal of Fluorine Chemistry, , vol. 35, p. 421 - 424 |
|
~%
1,1,3,5,6-Penta... CAS#:307-26-6 |
| Literature: Journal of the Chemical Society, , p. 4291,4300 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1,3,5,6-pentachloro-1,2,2,3,4,4,5,6,6-nonafluorohexane |