4-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)methyl]-N,N-diethylpiperazine-1-carboxamide structure
|
Common Name | 4-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)methyl]-N,N-diethylpiperazine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 30146-59-9 | Molecular Weight | 378.47300 | |
| Density | 1.26g/cm3 | Boiling Point | 622.2ºC at 760mmHg | |
| Molecular Formula | C17H30N8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.1ºC | |
| Name | 4-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)methyl]-N,N-diethylpiperazine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 622.2ºC at 760mmHg |
| Molecular Formula | C17H30N8O2 |
| Molecular Weight | 378.47300 |
| Flash Point | 330.1ºC |
| Exact Mass | 378.24900 |
| PSA | 104.68000 |
| Index of Refraction | 1.594 |
| InChIKey | BHJZGGAYGFSGSH-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)N1CCN(Cc2nc(N)nc(N3CCOCC3)n2)CC1 |
|
~%
4-[(4-amino-6-m... CAS#:30146-59-9 |
| Literature: Das,P.C. et al. Indian Journal of Chemistry, 1970 , vol. 8, p. 590 - 592 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| af 62 |