Octanoic acid, I(2)-ester with chloramphenicol
Modify Date: 2025-09-26 13:30:56
Octanoic acid, I(2)-ester with chloramphenicol structure
|
Common Name | Octanoic acid, I(2)-ester with chloramphenicol | ||
|---|---|---|---|---|
| CAS Number | 115189-27-0 | Molecular Weight | 449.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26Cl2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Octanoic acid, I(2)-ester with chloramphenicol |
|---|
| Molecular Formula | C19H26Cl2N2O6 |
|---|---|
| Molecular Weight | 449.3 |
| InChIKey | INNLHVFIJBPUPL-NVXWUHKLSA-N |
| SMILES | CCCCCCCC(=O)OC(c1ccc([N+](=O)[O-])cc1)C(CO)NC(=O)C(Cl)Cl |