methyl 2-oxo-1-oxaspiro[4.5]decane-4-carboxylate
Modify Date: 2025-08-25 19:49:13
![methyl 2-oxo-1-oxaspiro[4.5]decane-4-carboxylate Structure](https://image.chemsrc.com/caspic/200/2819-57-0.png)
methyl 2-oxo-1-oxaspiro[4.5]decane-4-carboxylate structure
|
Common Name | methyl 2-oxo-1-oxaspiro[4.5]decane-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2819-57-0 | Molecular Weight | 212.24200 | |
| Density | 1.17g/cm3 | Boiling Point | 354.9ºC at 760 mmHg | |
| Molecular Formula | C11H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
| Name | methyl 2-oxo-1-oxaspiro[4.5]decane-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 354.9ºC at 760 mmHg |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24200 |
| Flash Point | 180.6ºC |
| Exact Mass | 212.10500 |
| PSA | 52.60000 |
| LogP | 1.42540 |
| Vapour Pressure | 3.24E-05mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | CWZOQLTZSMTILL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(=O)OC12CCCCC2 |
|
~66%
methyl 2-oxo-1-... CAS#:2819-57-0 |
| Literature: Shono, Tatsuya; Hamaguchi, Hiroshi; Nishiguchi, Ikuzo; Sasaki, Manji; Miyamoto, Tetsuya; et.al. Chemistry Letters, 1981 , p. 1217 - 1220 |
|
~%
methyl 2-oxo-1-... CAS#:2819-57-0 |
| Literature: Johnson et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3021 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| methyl 3-oxo-4-oxaspiro[4.5]decane-1-carboxylate |
| 2-oxo-1-oxa-spiro[4.5]decane-4-carboxylic acid methyl ester |
| 1-Oxaspiro(4.5)decane-4-carboxylic acid,2-oxo-,methyl ester |
| 2-Oxo-1-oxa-spiro[4.5]decan-4-carbonsaeure-methylester |
| HMS653I09 |