2-(decanoylamino)-3-phenylpropanoic acid
Modify Date: 2025-09-13 17:44:26
2-(decanoylamino)-3-phenylpropanoic acid structure
|
Common Name | 2-(decanoylamino)-3-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 26060-97-9 | Molecular Weight | 319.43800 | |
| Density | 1.048g/cm3 | Boiling Point | 519.4ºC at 760 mmHg | |
| Molecular Formula | C19H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.9ºC | |
| Name | 2-(decanoylamino)-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.048g/cm3 |
|---|---|
| Boiling Point | 519.4ºC at 760 mmHg |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.43800 |
| Flash Point | 267.9ºC |
| Exact Mass | 319.21500 |
| PSA | 69.89000 |
| LogP | 4.77950 |
| Vapour Pressure | 1.29E-11mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | BPZWMTJHFOPXCT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)NC(Cc1ccccc1)C(=O)O |
|
~%
2-(decanoylamin... CAS#:26060-97-9 |
| Literature: Ohkubo, Katsutoshi; Urabe, Kenji; Yamamoto, Junji; Sagawa, Takashi; Usui, Satoshi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1995 , # 23 p. 2957 - 2960 |
|
~%
2-(decanoylamin... CAS#:26060-97-9 |
| Literature: Ohkubo, Katsutoshi; Ishida, Hitoshi; Yamaki, Kazuhiro; Kawata, Masahiko Chemistry Letters, 1991 , # 10 p. 1723 - 1726 |
|
~%
2-(decanoylamin... CAS#:26060-97-9 |
| Literature: Miroshnikov,A.I. et al. J. Gen. Chem. USSR (Engl. Transl.), 1970 , vol. 40, # 1 p. 223 - 235,202 - 213 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| L-Phenylalanine,N-(1-oxodecyl) |
| Dec-L-Phe-OH |
| N-decanoylphenylalanine |