2,2,2-trifluoro-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide structure
|
Common Name | 2,2,2-trifluoro-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 22926-51-8 | Molecular Weight | 239.21800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8F3N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8F3N3OS |
|---|---|
| Molecular Weight | 239.21800 |
| Exact Mass | 239.03400 |
| PSA | 86.61000 |
| LogP | 2.64090 |
| InChIKey | IOKKWYKFPAEGCM-UHFFFAOYSA-N |
| SMILES | CCCc1nnc(NC(=O)C(F)(F)F)s1 |
|
~84%
2,2,2-trifluoro... CAS#:22926-51-8 |
| Literature: Nagao, Yoshimitsu; Hirata, Terukage; Goto, Satoru; Sano, Shigeki; Kakehi, Akikazu; Iizuka, Kinji; Shiro, Motoo Journal of the American Chemical Society, 1998 , vol. 120, # 13 p. 3104 - 3110 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-n-propyl-2-trifluoroacetylamino-1,3,4-thiadiazole |