Cy3B NHS ester
Modify Date: 2025-08-26 15:31:15
Cy3B NHS ester structure
|
Common Name | Cy3B NHS ester | ||
|---|---|---|---|---|
| CAS Number | 228272-52-4 | Molecular Weight | 657.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H35N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cy3B NHS esterCy3B NHS ester is a fluorescent dye compound that is commonly used in biomarking and fluorescent labeling experiments, especially for labeling biomolecules containing amino functional groups (amine groups), such as proteins, antibodies or peptides. |
| Name | Cy3B NHS ester |
|---|
| Description | Cy3B NHS ester is a fluorescent dye compound that is commonly used in biomarking and fluorescent labeling experiments, especially for labeling biomolecules containing amino functional groups (amine groups), such as proteins, antibodies or peptides. |
|---|---|
| Related Catalog |
| Molecular Formula | C35H35N3O8S |
|---|---|
| Molecular Weight | 657.73 |
| InChIKey | PLHHGVSUNRYQLJ-UHFFFAOYSA-N |
| SMILES | CC1(C)C2=C3C=C4C5=[N+](CCC4OC3CCN2c2ccc(CC(=O)ON3C(=O)CCC3=O)cc21)c1ccc(S(=O)(=O)[O-])cc1C5(C)C |