5-bromo-2-(4-bromo-2-hydroxyphenoxy)phenol structure
|
Common Name | 5-bromo-2-(4-bromo-2-hydroxyphenoxy)phenol | ||
|---|---|---|---|---|
| CAS Number | 22649-30-5 | Molecular Weight | 359.99800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-2-(4-bromo-2-hydroxyphenoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8Br2O3 |
|---|---|
| Molecular Weight | 359.99800 |
| Exact Mass | 357.88400 |
| PSA | 49.69000 |
| LogP | 4.41510 |
| InChIKey | FQLQYHNJOGUHFE-UHFFFAOYSA-N |
| SMILES | Oc1cc(Br)ccc1Oc1ccc(Br)cc1O |
|
~81%
5-bromo-2-(4-br... CAS#:22649-30-5 |
| Literature: Deng, Gang; James, Tony D.; Shinkai, Seiji Journal of the American Chemical Society, 1994 , vol. 116, # 11 p. 4567 - 4572 |
|
~%
5-bromo-2-(4-br... CAS#:22649-30-5 |
| Literature: I.G. Farbenind. Patent: DE569726 , 1930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 19, p. 1521 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,4'-Dibrom-2,2'-oxy-di-phenol |
| 2,2'-dihydroxy-5,5'-dibromodiphenyl ether |
| 4,4'-dibromo-2,2'-oxy-di-phenol |