1-methoxy-4-(4-methoxyphenyl)selanylbenzene structure
|
Common Name | 1-methoxy-4-(4-methoxyphenyl)selanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 22216-66-6 | Molecular Weight | 293.22000 | |
| Density | N/A | Boiling Point | 376.3ºC at 760mmHg | |
| Molecular Formula | C14H14O2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | 1-methoxy-4-(4-methoxyphenyl)selanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 376.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H14O2Se |
| Molecular Weight | 293.22000 |
| Flash Point | 181.4ºC |
| Exact Mass | 294.01600 |
| PSA | 18.46000 |
| LogP | 1.35880 |
| Vapour Pressure | 1.59E-05mmHg at 25°C |
| InChIKey | LURBCACEKXUJEG-UHFFFAOYSA-N |
| SMILES | COc1ccc([Se]c2ccc(OC)cc2)cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| bis-4-methoxylphenylselenide |